2,4,6-Trimethoxy-benzoic acid methyl ester CAS NO.29723-28-2

1. Introduction of 2,4,6-Trimethoxy-benzoic acid methyl ester

Benzoic acid, 2, 4, 6-trimethoxy-, methyl ester(29723-28-2), is

1. Introduction of 2,4,6-Trimethoxy-benzoic acid methyl ester

Benzoic acid, 2, 4, 6-trimethoxy-, methyl ester(29723-28-2), is also known as 2, 4, 6-Trimethoxy-benzoic acid methyl ester. This chemical's molecular formula is C₁₁H₁₄O₅ and molecular weight is 226.23. What's more, its IUPAC name is Methyl 2, 4, 6-trimethoxybenzoate.

2. Basic Information of 2,4,6-Trimethoxy-benzoic acid methyl ester

1). Properties of 2,4,6-Trimethoxy-benzoic acid methyl ester

Physical properties about Benzoic acid, 2, 4, 6-trimethoxy-, methyl ester are: (1)ACD/LogP: 1.60; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 5; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 5; (6)Polar Surface Area: 53.99 ?2; (7)Index of Refraction: 1.494; (8)Molar Refractivity: 58.06 cm³; (9)Molar Volume: 199.3 cm³; (10)Polarizability: 23.01×10-24 cm³; (11)Surface Tension: 34.2 dyne/cm; (12)Density: 1.134 g/cm³; (13)Flash Point: 152 °C; (14)Enthalpy of Vaporization: 58.78 kJ/mol; (15)Boiling Point: 343.8 °C at 760 mmHg; (16)Vapour Pressure: 6.85E-05 mmHg at 25 °C.

2). Structure of 2,4,6-Trimethoxy-benzoic acid methyl ester
You can still convert the following datas into molecular structure:
(1) SMILES: O=C(OC)c1c(OC)cc(OC)cc1OC
(2) InChI: InChI=1/C11H14O5/c1-13-7-5-8(14-2)10(11(12)16-4)9(6-7)15-3/h5-6H,1-4H3
(3) InChIKey: CEARZEQLIHOYSV-UHFFFAOYAO